About 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide
2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide (PubChem CID 80805960) has the molecular formula C13H22FN5O
and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide |
| PubChem CID | 80805960 |
| Molecular Formula | C13H22FN5O |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)c1nc(NCC)ncc1F |
| InChI | InChI=1S/C13H22FN5O/c1-5-7-19(9-11(20)18(3)4)12-10(14)8-16-13(17-12)15-6-2/h8H,5-7,9H2,1-4H3,(H,15,16,17) |
| InChIKey | SEHQXZONJPYJOL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide (CID 80805960) is 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide is CCCN(CC(=O)N(C)C)c1nc(NCC)ncc1F.
What is the InChIKey of 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide?
The InChIKey is SEHQXZONJPYJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22FN5O/c1-5-7-19(9-11(20)18(3)4)12-10(14)8-16-13(17-12)15-6-2/h8H,5-7,9H2,1-4H3,(H,15,16,17).
What are the key properties of 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide?
2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide has a molecular weight of 283.35 g/mol, XLogP of 1.35, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propylamino]-N,N-dimethylacetamide is sourced from PubChem (CID 80805960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).