C12H22N6O — CID 80806397
2-[[2-amino-6-(propylamino)pyrimidin-4-yl]-propan-2-ylamino]acetamide (PubChem CID 80806397) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]-propan-2-ylamino]acetamide.
| Compound Name | 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]-propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 80806397 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]-propan-2-ylamino]acetamide |
| SMILES | CCCNc1cc(N(CC(N)=O)C(C)C)nc(N)n1 |
| InChI | InChI=1S/C12H22N6O/c1-4-5-15-10-6-11(17-12(14)16-10)18(8(2)3)7-9(13)19/h6,8H,4-5,7H2,1-3H3,(H2,13,19)(H3,14,15,16,17) |
| InChIKey | KKJRUXFQFAVWAP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |