About 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide
1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide (PubChem CID 80806891) has the molecular formula C13H18N6O
and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide |
| PubChem CID | 80806891 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1c1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C13H18N6O/c1-8-2-3-9(11(15)20)6-19(8)13-12-16-4-5-18(12)7-10(14)17-13/h4-5,7-9H,2-3,6,14H2,1H3,(H2,15,20) |
| InChIKey | WCRWMJDFZXXJNU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide?
The IUPAC name of 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide (CID 80806891) is 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide.
What is the SMILES notation for 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide?
The canonical SMILES for 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide is CC1CCC(C(N)=O)CN1c1nc(N)cn2ccnc12.
What is the InChIKey of 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide?
The InChIKey is WCRWMJDFZXXJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6O/c1-8-2-3-9(11(15)20)6-19(8)13-12-16-4-5-18(12)7-10(14)17-13/h4-5,7-9H,2-3,6,14H2,1H3,(H2,15,20).
What are the key properties of 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide?
1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide has a molecular weight of 274.33 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-aminoimidazo[1,2-a]pyrazin-8-yl)-6-methylpiperidine-3-carboxamide is sourced from PubChem (CID 80806891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).