C14H18BrN5 — CID 80807102
4-N-[1-(3-bromophenyl)ethyl]-6-N-ethylpyrimidine-2,4,6-triamine (PubChem CID 80807102) has the molecular formula C14H18BrN5 and a molecular weight of 336.24 g/mol. Its IUPAC name is 4-N-[1-(3-bromophenyl)ethyl]-6-N-ethylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-[1-(3-bromophenyl)ethyl]-6-N-ethylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80807102 |
| Molecular Formula | C14H18BrN5 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 4-N-[1-(3-bromophenyl)ethyl]-6-N-ethylpyrimidine-2,4,6-triamine |
| SMILES | CCNc1cc(NC(C)c2cccc(Br)c2)nc(N)n1 |
| InChI | InChI=1S/C14H18BrN5/c1-3-17-12-8-13(20-14(16)19-12)18-9(2)10-5-4-6-11(15)7-10/h4-9H,3H2,1-2H3,(H4,16,17,18,19,20) |
| InChIKey | QQLFRJMGPVNKJK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |