C13H22N6O — CID 80807429
2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 80807429) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80807429 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(NC2CCN3CCCCC23)nc(OC)n1 |
| InChI | InChI=1S/C13H22N6O/c1-14-11-16-12(18-13(17-11)20-2)15-9-6-8-19-7-4-3-5-10(9)19/h9-10H,3-8H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | UFYSNBJIBORBSB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |