C13H19N7O — CID 80808945
4-N-[(2-methoxy-4-pyridinyl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80808945) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-N-[(2-methoxy-4-pyridinyl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(2-methoxy-4-pyridinyl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80808945 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-N-[(2-methoxy-4-pyridinyl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCc2ccnc(OC)c2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H19N7O/c1-14-11-17-12(19-13(18-11)20(2)3)16-8-9-5-6-15-10(7-9)21-4/h5-7H,8H2,1-4H3,(H2,14,16,17,18,19) |
| InChIKey | BIHQJFJYYHXBAH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |