C12H23N5O — CID 80810065
2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-pentan-3-ylamino]ethanol (PubChem CID 80810065) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-pentan-3-ylamino]ethanol.
| Compound Name | 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-pentan-3-ylamino]ethanol |
|---|---|
| PubChem CID | 80810065 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-pentan-3-ylamino]ethanol |
| SMILES | CCC(CC)N(CCO)c1cc(NC)nc(N)n1 |
| InChI | InChI=1S/C12H23N5O/c1-4-9(5-2)17(6-7-18)11-8-10(14-3)15-12(13)16-11/h8-9,18H,4-7H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | HZNLVFNCXYBGTF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |