C14H18N6O — CID 80812613
6-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80812613) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 6-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80812613 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 6-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(N2CCOc3ccccc3C2)n1 |
| InChI | InChI=1S/C14H18N6O/c1-19(2)13-16-12(15)17-14(18-13)20-7-8-21-11-6-4-3-5-10(11)9-20/h3-6H,7-9H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | XIEHMYLXCSBZNS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |