C11H15FN4O — CID 80812727
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoropyrimidin-2-amine (PubChem CID 80812727) has the molecular formula C11H15FN4O and a molecular weight of 238.27 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80812727 |
| Molecular Formula | C11H15FN4O |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C11H15FN4O/c12-7-6-14-11(13)15-10(7)16-4-5-17-9-3-1-2-8(9)16/h6,8-9H,1-5H2,(H2,13,14,15) |
| InChIKey | MAEYUGJDAVRYPU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |