C13H19FN4O — CID 80812733
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-ethyl-5-fluoropyrimidin-2-amine (PubChem CID 80812733) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-ethyl-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-ethyl-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80812733 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-ethyl-5-fluoropyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C13H19FN4O/c1-2-15-13-16-8-9(14)12(17-13)18-6-7-19-11-5-3-4-10(11)18/h8,10-11H,2-7H2,1H3,(H,15,16,17) |
| InChIKey | MWNOZJUWQXSYQQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |