C12H17N7O2 — CID 80814642
4-N-[(1-methylimidazol-2-yl)methyl]-5-nitro-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80814642) has the molecular formula C12H17N7O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-N-[(1-methylimidazol-2-yl)methyl]-5-nitro-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[(1-methylimidazol-2-yl)methyl]-5-nitro-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80814642 |
| Molecular Formula | C12H17N7O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-N-[(1-methylimidazol-2-yl)methyl]-5-nitro-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(NCc2nccn2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N7O2/c1-3-4-14-11-10(19(20)21)12(17-8-16-11)15-7-9-13-5-6-18(9)2/h5-6,8H,3-4,7H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | BYAYSIAFXHZYKG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|