About 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine
6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 80815215) has the molecular formula C14H21N5O
and a molecular weight of 275.36 g/mol. Its IUPAC name is 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine.
Molecular Properties
| Compound Name | 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine |
| PubChem CID | 80815215 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CCNc1cn2ccnc2c(NCC2CCCCO2)n1 |
| InChI | InChI=1S/C14H21N5O/c1-2-15-12-10-19-7-6-16-14(19)13(18-12)17-9-11-5-3-4-8-20-11/h6-7,10-11,15H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | FZAMNCLRXNSQFF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine?
The IUPAC name of 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine (CID 80815215) is 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine.
What is the SMILES notation for 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine?
The canonical SMILES for 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine is CCNc1cn2ccnc2c(NCC2CCCCO2)n1.
What is the InChIKey of 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine?
The InChIKey is FZAMNCLRXNSQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O/c1-2-15-12-10-19-7-6-16-14(19)13(18-12)17-9-11-5-3-4-8-20-11/h6-7,10-11,15H,2-5,8-9H2,1H3,(H,17,18).
What are the key properties of 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine?
6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine has a molecular weight of 275.36 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-ethyl-8-N-(oxan-2-ylmethyl)imidazo[1,2-a]pyrazine-6,8-diamine is sourced from PubChem (CID 80815215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).