C11H12F3N3O2 — CID 80815777
3-N-cyclopropyl-2-nitro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine (PubChem CID 80815777) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is 3-N-cyclopropyl-2-nitro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine.
| Compound Name | 3-N-cyclopropyl-2-nitro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80815777 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-N-cyclopropyl-2-nitro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine |
| SMILES | Nc1cccc(N(CC(F)(F)F)C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F3N3O2/c12-11(13,14)6-16(7-4-5-7)9-3-1-2-8(15)10(9)17(18)19/h1-3,7H,4-6,15H2 |
| InChIKey | LBFHTFLHFDAJEA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|