C12H19N9 — CID 80816943
4-(1,2,4-triazol-1-yl)-6-(3,3,4-trimethylpiperazin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80816943) has the molecular formula C12H19N9 and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-yl)-6-(3,3,4-trimethylpiperazin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,2,4-triazol-1-yl)-6-(3,3,4-trimethylpiperazin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80816943 |
| Molecular Formula | C12H19N9 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-(1,2,4-triazol-1-yl)-6-(3,3,4-trimethylpiperazin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCN(c2nc(N)nc(-n3cncn3)n2)CC1(C)C |
| InChI | InChI=1S/C12H19N9/c1-12(2)6-20(5-4-19(12)3)10-16-9(13)17-11(18-10)21-8-14-7-15-21/h7-8H,4-6H2,1-3H3,(H2,13,16,17,18) |
| InChIKey | CSZBOTVCJGOBRU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |