About 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine
8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 80817464) has the molecular formula C14H14FN5
and a molecular weight of 271.30 g/mol. Its IUPAC name is 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine.
Molecular Properties
| Compound Name | 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine |
| PubChem CID | 80817464 |
| Molecular Formula | C14H14FN5 |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CCN(c1ccccc1F)c1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C14H14FN5/c1-2-20(11-6-4-3-5-10(11)15)14-13-17-7-8-19(13)9-12(16)18-14/h3-9H,2,16H2,1H3 |
| InChIKey | IMPRKWNURRYBCT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine?
The IUPAC name of 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine (CID 80817464) is 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine.
What is the SMILES notation for 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine?
The canonical SMILES for 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine is CCN(c1ccccc1F)c1nc(N)cn2ccnc12.
What is the InChIKey of 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine?
The InChIKey is IMPRKWNURRYBCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN5/c1-2-20(11-6-4-3-5-10(11)15)14-13-17-7-8-19(13)9-12(16)18-14/h3-9H,2,16H2,1H3.
What are the key properties of 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine?
8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine has a molecular weight of 271.30 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-ethyl-8-N-(2-fluorophenyl)imidazo[1,2-a]pyrazine-6,8-diamine is sourced from PubChem (CID 80817464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).