C15H20N4 — CID 80817498
4-N-(4-ethylphenyl)-4-N,2,5-trimethylpyrimidine-4,6-diamine (PubChem CID 80817498) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-N-(4-ethylphenyl)-4-N,2,5-trimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-ethylphenyl)-4-N,2,5-trimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80817498 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-N-(4-ethylphenyl)-4-N,2,5-trimethylpyrimidine-4,6-diamine |
| SMILES | CCc1ccc(N(C)c2nc(C)nc(N)c2C)cc1 |
| InChI | InChI=1S/C15H20N4/c1-5-12-6-8-13(9-7-12)19(4)15-10(2)14(16)17-11(3)18-15/h6-9H,5H2,1-4H3,(H2,16,17,18) |
| InChIKey | AGVDPHIYPJTOEU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |