C10H17N5O — CID 80817558
4-N-(2-methoxycyclopentyl)pyrimidine-2,4,6-triamine (PubChem CID 80817558) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-N-(2-methoxycyclopentyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-methoxycyclopentyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80817558 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-N-(2-methoxycyclopentyl)pyrimidine-2,4,6-triamine |
| SMILES | COC1CCCC1Nc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C10H17N5O/c1-16-7-4-2-3-6(7)13-9-5-8(11)14-10(12)15-9/h5-7H,2-4H2,1H3,(H5,11,12,13,14,15) |
| InChIKey | PVRZLMYGEVDSBV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |