C14H20N6 — CID 80818142
2-N-(3,5-dimethylphenyl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80818142) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 2-N-(3,5-dimethylphenyl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(3,5-dimethylphenyl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80818142 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 2-N-(3,5-dimethylphenyl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1cc(C)cc(N(C)c2nc(N)nc(N(C)C)n2)c1 |
| InChI | InChI=1S/C14H20N6/c1-9-6-10(2)8-11(7-9)20(5)14-17-12(15)16-13(18-14)19(3)4/h6-8H,1-5H3,(H2,15,16,17,18) |
| InChIKey | PZQBGDTYNSMFOF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |