C13H21F3N4O — CID 80819387
5-ethyl-6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 80819387) has the molecular formula C13H21F3N4O and a molecular weight of 306.33 g/mol. Its IUPAC name is 5-ethyl-6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80819387 |
| Molecular Formula | C13H21F3N4O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-ethyl-6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(NCCOCC(F)(F)F)c1CC |
| InChI | InChI=1S/C13H21F3N4O/c1-3-5-17-11-10(4-2)12(20-9-19-11)18-6-7-21-8-13(14,15)16/h9H,3-8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | OIVQGQSKRBAQJO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|