About 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide
2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide (PubChem CID 80820561) has the molecular formula C13H23N5O
and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide |
| PubChem CID | 80820561 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide |
| SMILES | CNc1nc(C)nc(N(CC(N)=O)CC(C)C)c1C |
| InChI | InChI=1S/C13H23N5O/c1-8(2)6-18(7-11(14)19)13-9(3)12(15-5)16-10(4)17-13/h8H,6-7H2,1-5H3,(H2,14,19)(H,15,16,17) |
| InChIKey | IMGCCBDMVGAMOL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide?
The IUPAC name of 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide (CID 80820561) is 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide.
What is the SMILES notation for 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide?
The canonical SMILES for 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide is CNc1nc(C)nc(N(CC(N)=O)CC(C)C)c1C.
What is the InChIKey of 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide?
The InChIKey is IMGCCBDMVGAMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O/c1-8(2)6-18(7-11(14)19)13-9(3)12(15-5)16-10(4)17-13/h8H,6-7H2,1-5H3,(H2,14,19)(H,15,16,17).
What are the key properties of 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide?
2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide has a molecular weight of 265.36 g/mol, XLogP of 1.08, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]-(2-methylpropyl)amino]acetamide is sourced from PubChem (CID 80820561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).