C11H20N6O — CID 80820844
2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide (PubChem CID 80820844) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 80820844 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[[2-amino-6-(methylamino)pyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide |
| SMILES | CNc1cc(N(C)CC(=O)NC(C)C)nc(N)n1 |
| InChI | InChI=1S/C11H20N6O/c1-7(2)14-10(18)6-17(4)9-5-8(13-3)15-11(12)16-9/h5,7H,6H2,1-4H3,(H,14,18)(H3,12,13,15,16) |
| InChIKey | CTPVQGSAHAKPKQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |