C11H16ClN5O — CID 80821198
2-[[5-chloro-2-(methylamino)pyrimidin-4-yl]-methylamino]-N-cyclopropylacetamide (PubChem CID 80821198) has the molecular formula C11H16ClN5O and a molecular weight of 269.74 g/mol. Its IUPAC name is 2-[[5-chloro-2-(methylamino)pyrimidin-4-yl]-methylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[[5-chloro-2-(methylamino)pyrimidin-4-yl]-methylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 80821198 |
| Molecular Formula | C11H16ClN5O |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-[[5-chloro-2-(methylamino)pyrimidin-4-yl]-methylamino]-N-cyclopropylacetamide |
| SMILES | CNc1ncc(Cl)c(N(C)CC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C11H16ClN5O/c1-13-11-14-5-8(12)10(16-11)17(2)6-9(18)15-7-3-4-7/h5,7H,3-4,6H2,1-2H3,(H,15,18)(H,13,14,16) |
| InChIKey | MPVXNGUBMJJSPO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |