C12H20N4 — CID 80821891
6-(2,3-dimethylpiperidin-1-yl)-N-methylpyrimidin-4-amine (PubChem CID 80821891) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-(2,3-dimethylpiperidin-1-yl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-(2,3-dimethylpiperidin-1-yl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80821891 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 6-(2,3-dimethylpiperidin-1-yl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(N2CCCC(C)C2C)ncn1 |
| InChI | InChI=1S/C12H20N4/c1-9-5-4-6-16(10(9)2)12-7-11(13-3)14-8-15-12/h7-10H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | POVIHSHDKSHHHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |