C14H16N6 — CID 80823397
4-[[2-amino-6-(ethylamino)pyrimidin-4-yl]-methylamino]benzonitrile (PubChem CID 80823397) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-[[2-amino-6-(ethylamino)pyrimidin-4-yl]-methylamino]benzonitrile.
| Compound Name | 4-[[2-amino-6-(ethylamino)pyrimidin-4-yl]-methylamino]benzonitrile |
|---|---|
| PubChem CID | 80823397 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-[[2-amino-6-(ethylamino)pyrimidin-4-yl]-methylamino]benzonitrile |
| SMILES | CCNc1cc(N(C)c2ccc(C#N)cc2)nc(N)n1 |
| InChI | InChI=1S/C14H16N6/c1-3-17-12-8-13(19-14(16)18-12)20(2)11-6-4-10(9-15)5-7-11/h4-8H,3H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | CJEHVBVXIZDBEN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |