C11H20N4O — CID 80823623
4-N-(3-methoxypropyl)-4-N,6-N,5-trimethylpyrimidine-4,6-diamine (PubChem CID 80823623) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-4-N,6-N,5-trimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-methoxypropyl)-4-N,6-N,5-trimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80823623 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-N-(3-methoxypropyl)-4-N,6-N,5-trimethylpyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(N(C)CCCOC)c1C |
| InChI | InChI=1S/C11H20N4O/c1-9-10(12-2)13-8-14-11(9)15(3)6-5-7-16-4/h8H,5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | BXWVQXKKDGBXPI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|