C15H17N5 — CID 80823780
3-[[methyl-[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]methyl]benzonitrile (PubChem CID 80823780) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-[[methyl-[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[methyl-[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 80823780 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-[[methyl-[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]methyl]benzonitrile |
| SMILES | CNc1ncc(C)c(N(C)Cc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C15H17N5/c1-11-9-18-15(17-2)19-14(11)20(3)10-13-6-4-5-12(7-13)8-16/h4-7,9H,10H2,1-3H3,(H,17,18,19) |
| InChIKey | XOMSQFSMGDDHOY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |