C16H27ClN4 — CID 80823869
5-chloro-4-(4-propan-2-ylazepan-1-yl)-N-propylpyrimidin-2-amine (PubChem CID 80823869) has the molecular formula C16H27ClN4 and a molecular weight of 310.87 g/mol. Its IUPAC name is 5-chloro-4-(4-propan-2-ylazepan-1-yl)-N-propylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-(4-propan-2-ylazepan-1-yl)-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80823869 |
| Molecular Formula | C16H27ClN4 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 5-chloro-4-(4-propan-2-ylazepan-1-yl)-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(Cl)c(N2CCCC(C(C)C)CC2)n1 |
| InChI | InChI=1S/C16H27ClN4/c1-4-8-18-16-19-11-14(17)15(20-16)21-9-5-6-13(7-10-21)12(2)3/h11-13H,4-10H2,1-3H3,(H,18,19,20) |
| InChIKey | KOLKJQBBDLYJMN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |