About N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine
N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine (PubChem CID 80823874) has the molecular formula C11H16F3N5
and a molecular weight of 275.28 g/mol. Its IUPAC name is N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine |
| PubChem CID | 80823874 |
| Molecular Formula | C11H16F3N5 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine |
| SMILES | CNc1cncc(N2CCN(CC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C11H16F3N5/c1-15-9-6-16-7-10(17-9)19-4-2-18(3-5-19)8-11(12,13)14/h6-7H,2-5,8H2,1H3,(H,15,17) |
| InChIKey | PXNQBCGSXUOWBD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine?
The IUPAC name of N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine (CID 80823874) is N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine.
What is the SMILES notation for N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine?
The canonical SMILES for N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine is CNc1cncc(N2CCN(CC(F)(F)F)CC2)n1.
What is the InChIKey of N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine?
The InChIKey is PXNQBCGSXUOWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N5/c1-15-9-6-16-7-10(17-9)19-4-2-18(3-5-19)8-11(12,13)14/h6-7H,2-5,8H2,1H3,(H,15,17).
What are the key properties of N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine?
N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine has a molecular weight of 275.28 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazin-2-amine is sourced from PubChem (CID 80823874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).