C13H25N5O2 — CID 80824057
6-ethoxy-2-N-(3-methoxypropyl)-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 80824057) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 6-ethoxy-2-N-(3-methoxypropyl)-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(3-methoxypropyl)-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80824057 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 6-ethoxy-2-N-(3-methoxypropyl)-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(OCC)nc(N(C)CCCOC)n1 |
| InChI | InChI=1S/C13H25N5O2/c1-5-8-14-11-15-12(17-13(16-11)20-6-2)18(3)9-7-10-19-4/h5-10H2,1-4H3,(H,14,15,16,17) |
| InChIKey | RASGIRDOTLNJRE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|