About 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine
4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine (PubChem CID 80824282) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine |
| PubChem CID | 80824282 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine |
| SMILES | CCNc1ncc(C)c(N2CCC(C)(C)CC2)n1 |
| InChI | InChI=1S/C14H24N4/c1-5-15-13-16-10-11(2)12(17-13)18-8-6-14(3,4)7-9-18/h10H,5-9H2,1-4H3,(H,15,16,17) |
| InChIKey | HSIXMTMRWZLRDV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine?
The IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine (CID 80824282) is 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine.
What is the SMILES notation for 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine?
The canonical SMILES for 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine is CCNc1ncc(C)c(N2CCC(C)(C)CC2)n1.
What is the InChIKey of 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine?
The InChIKey is HSIXMTMRWZLRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4/c1-5-15-13-16-10-11(2)12(17-13)18-8-6-14(3,4)7-9-18/h10H,5-9H2,1-4H3,(H,15,16,17).
What are the key properties of 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine?
4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine has a molecular weight of 248.37 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpiperidin-1-yl)-N-ethyl-5-methylpyrimidin-2-amine is sourced from PubChem (CID 80824282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).