C9H14N6O2 — CID 80824373
2-[(2-amino-5-methylpyrimidin-4-yl)-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 80824373) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[(2-amino-5-methylpyrimidin-4-yl)-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[(2-amino-5-methylpyrimidin-4-yl)-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 80824373 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[(2-amino-5-methylpyrimidin-4-yl)-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | Cc1cnc(N)nc1N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C9H14N6O2/c1-5-2-13-9(12)14-8(5)15(3-6(10)16)4-7(11)17/h2H,3-4H2,1H3,(H2,10,16)(H2,11,17)(H2,12,13,14) |
| InChIKey | JPTFNDGCVCCLED-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |