C11H18FN5 — CID 80824832
4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-5-fluoropyrimidin-2-amine (PubChem CID 80824832) has the molecular formula C11H18FN5 and a molecular weight of 239.30 g/mol. Its IUPAC name is 4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-5-fluoropyrimidin-2-amine.
| Compound Name | 4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80824832 |
| Molecular Formula | C11H18FN5 |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-5-fluoropyrimidin-2-amine |
| SMILES | CN(C)CC1CCCN1c1nc(N)ncc1F |
| InChI | InChI=1S/C11H18FN5/c1-16(2)7-8-4-3-5-17(8)10-9(12)6-14-11(13)15-10/h6,8H,3-5,7H2,1-2H3,(H2,13,14,15) |
| InChIKey | ITUSCSQKEHIKBG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |