C13H24N6 — CID 80826737
6-(2,4-dimethylpiperidin-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80826737) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 6-(2,4-dimethylpiperidin-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,4-dimethylpiperidin-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80826737 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 6-(2,4-dimethylpiperidin-1-yl)-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C)nc(N2CCC(C)CC2C)n1 |
| InChI | InChI=1S/C13H24N6/c1-9-6-7-19(10(2)8-9)13-16-11(14-3)15-12(17-13)18(4)5/h9-10H,6-8H2,1-5H3,(H,14,15,16,17) |
| InChIKey | COYKPQCHLKPIFL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |