C13H10F3N5 — CID 80829212
4-[(2-amino-6-methylpyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 80829212) has the molecular formula C13H10F3N5 and a molecular weight of 293.25 g/mol. Its IUPAC name is 4-[(2-amino-6-methylpyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(2-amino-6-methylpyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 80829212 |
| Molecular Formula | C13H10F3N5 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-[(2-amino-6-methylpyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cc(Nc2ccc(C#N)c(C(F)(F)F)c2)nc(N)n1 |
| InChI | InChI=1S/C13H10F3N5/c1-7-4-11(21-12(18)19-7)20-9-3-2-8(6-17)10(5-9)13(14,15)16/h2-5H,1H3,(H3,18,19,20,21) |
| InChIKey | BVHMNTZTFLNPOE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |