C15H18Cl2N4 — CID 80829581
4-N-(2,6-dichlorophenyl)-6-N-ethyl-5-propylpyrimidine-4,6-diamine (PubChem CID 80829581) has the molecular formula C15H18Cl2N4 and a molecular weight of 325.24 g/mol. Its IUPAC name is 4-N-(2,6-dichlorophenyl)-6-N-ethyl-5-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,6-dichlorophenyl)-6-N-ethyl-5-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80829581 |
| Molecular Formula | C15H18Cl2N4 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-N-(2,6-dichlorophenyl)-6-N-ethyl-5-propylpyrimidine-4,6-diamine |
| SMILES | CCCc1c(NCC)ncnc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H18Cl2N4/c1-3-6-10-14(18-4-2)19-9-20-15(10)21-13-11(16)7-5-8-12(13)17/h5,7-9H,3-4,6H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | JSDXDDJPWSSPOI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |