C12H23N5O — CID 80831552
2-N-(4-methylpentyl)-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine (PubChem CID 80831552) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-N-(4-methylpentyl)-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-methylpentyl)-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80831552 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 2-N-(4-methylpentyl)-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CCCNc1nc(N)nc(OC(C)C)n1 |
| InChI | InChI=1S/C12H23N5O/c1-8(2)6-5-7-14-11-15-10(13)16-12(17-11)18-9(3)4/h8-9H,5-7H2,1-4H3,(H3,13,14,15,16,17) |
| InChIKey | UBVLTASAFPTSJP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|