C12H23N5 — CID 80832143
4-N-(2-methylbutyl)-6-N-propylpyrimidine-2,4,6-triamine (PubChem CID 80832143) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-N-(2-methylbutyl)-6-N-propylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-methylbutyl)-6-N-propylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80832143 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 4-N-(2-methylbutyl)-6-N-propylpyrimidine-2,4,6-triamine |
| SMILES | CCCNc1cc(NCC(C)CC)nc(N)n1 |
| InChI | InChI=1S/C12H23N5/c1-4-6-14-10-7-11(17-12(13)16-10)15-8-9(3)5-2/h7,9H,4-6,8H2,1-3H3,(H4,13,14,15,16,17) |
| InChIKey | DMJMABBEVYQFHT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |