C13H16N6O2 — CID 80832762
4-[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]piperazine-2,6-dione (PubChem CID 80832762) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]piperazine-2,6-dione.
| Compound Name | 4-[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 80832762 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]piperazine-2,6-dione |
| SMILES | CCCNc1cn2ccnc2c(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C13H16N6O2/c1-2-3-14-9-6-18-5-4-15-12(18)13(16-9)19-7-10(20)17-11(21)8-19/h4-6,14H,2-3,7-8H2,1H3,(H,17,20,21) |
| InChIKey | RFLYMUUQGVRRJM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|