C12H20N4O2S3 — CID 80833716
6-(3-ethylsulfonylthiomorpholin-4-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80833716) has the molecular formula C12H20N4O2S3 and a molecular weight of 348.52 g/mol. Its IUPAC name is 6-(3-ethylsulfonylthiomorpholin-4-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(3-ethylsulfonylthiomorpholin-4-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80833716 |
| Molecular Formula | C12H20N4O2S3 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6-(3-ethylsulfonylthiomorpholin-4-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCS(=O)(=O)C1CSCCN1c1cc(NC)nc(SC)n1 |
| InChI | InChI=1S/C12H20N4O2S3/c1-4-21(17,18)11-8-20-6-5-16(11)10-7-9(13-2)14-12(15-10)19-3/h7,11H,4-6,8H2,1-3H3,(H,13,14,15) |
| InChIKey | RVCNLPMECKIRJK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |