C12H20N8O — CID 80836471
7-[4-(dimethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 80836471) has the molecular formula C12H20N8O and a molecular weight of 292.35 g/mol. Its IUPAC name is 7-[4-(dimethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[4-(dimethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 80836471 |
| Molecular Formula | C12H20N8O |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 7-[4-(dimethylamino)-6-(methylamino)-1,3,5-triazin-2-yl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CNc1nc(N(C)C)nc(N2CCN3C(=O)NCC3C2)n1 |
| InChI | InChI=1S/C12H20N8O/c1-13-9-15-10(18(2)3)17-11(16-9)19-4-5-20-8(7-19)6-14-12(20)21/h8H,4-7H2,1-3H3,(H,14,21)(H,13,15,16,17) |
| InChIKey | IJGYYULRHIFRLL-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |