C14H21N5O2 — CID 80836942
6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-5-nitropyridin-2-amine (PubChem CID 80836942) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-5-nitropyridin-2-amine.
| Compound Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80836942 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-5-nitropyridin-2-amine |
| SMILES | CNc1ccc([N+](=O)[O-])c(N2CCN3CCCCC3C2)n1 |
| InChI | InChI=1S/C14H21N5O2/c1-15-13-6-5-12(19(20)21)14(16-13)18-9-8-17-7-3-2-4-11(17)10-18/h5-6,11H,2-4,7-10H2,1H3,(H,15,16) |
| InChIKey | KCBBLYCWUJUUFT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|