About 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one
5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one (PubChem CID 80837147) has the molecular formula C13H21N5O
and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one |
| PubChem CID | 80837147 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one |
| SMILES | CCNc1nc(C)nc(NCC2CCC(=O)N2)c1C |
| InChI | InChI=1S/C13H21N5O/c1-4-14-12-8(2)13(17-9(3)16-12)15-7-10-5-6-11(19)18-10/h10H,4-7H2,1-3H3,(H,18,19)(H2,14,15,16,17) |
| InChIKey | FBGRRWICVGJWAV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one?
The IUPAC name of 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one (CID 80837147) is 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one?
The canonical SMILES for 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one is CCNc1nc(C)nc(NCC2CCC(=O)N2)c1C.
What is the InChIKey of 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one?
The InChIKey is FBGRRWICVGJWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O/c1-4-14-12-8(2)13(17-9(3)16-12)15-7-10-5-6-11(19)18-10/h10H,4-7H2,1-3H3,(H,18,19)(H2,14,15,16,17).
What are the key properties of 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one?
5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one has a molecular weight of 263.34 g/mol, XLogP of 1.22, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[[6-(ethylamino)-2,5-dimethylpyrimidin-4-yl]amino]methyl]pyrrolidin-2-one is sourced from PubChem (CID 80837147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).