C14H25N5O2 — CID 80839033
4-N-(2,2-dimethylheptyl)-6-N-methyl-5-nitropyrimidine-4,6-diamine (PubChem CID 80839033) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-N-(2,2-dimethylheptyl)-6-N-methyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,2-dimethylheptyl)-6-N-methyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80839033 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 4-N-(2,2-dimethylheptyl)-6-N-methyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCCC(C)(C)CNc1ncnc(NC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H25N5O2/c1-5-6-7-8-14(2,3)9-16-13-11(19(20)21)12(15-4)17-10-18-13/h10H,5-9H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | FHJSRTDFRZXTLI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|