C9H16N4S — CID 80839141
2-N,6-dimethyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine (PubChem CID 80839141) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-N,6-dimethyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,6-dimethyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80839141 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-N,6-dimethyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)cc(NCCSC)n1 |
| InChI | InChI=1S/C9H16N4S/c1-7-6-8(11-4-5-14-3)13-9(10-2)12-7/h6H,4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | VPUOKTMNXRPVPF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|