C14H26N4S — CID 80839154
4-N-(3-methylsulfanylpropyl)-6-N,5-dipropylpyrimidine-4,6-diamine (PubChem CID 80839154) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is 4-N-(3-methylsulfanylpropyl)-6-N,5-dipropylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-methylsulfanylpropyl)-6-N,5-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80839154 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-N-(3-methylsulfanylpropyl)-6-N,5-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCNc1ncnc(NCCCSC)c1CCC |
| InChI | InChI=1S/C14H26N4S/c1-4-7-12-13(15-8-5-2)17-11-18-14(12)16-9-6-10-19-3/h11H,4-10H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | VKSFZGLWOKSKNF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|