C13H19F4N3O — CID 80842287
5-propan-2-yl-N-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine (PubChem CID 80842287) has the molecular formula C13H19F4N3O and a molecular weight of 309.31 g/mol. Its IUPAC name is 5-propan-2-yl-N-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine.
| Compound Name | 5-propan-2-yl-N-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80842287 |
| Molecular Formula | C13H19F4N3O |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-propan-2-yl-N-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
| SMILES | CCCNc1ncnc(OCC(F)(F)C(F)F)c1C(C)C |
| InChI | InChI=1S/C13H19F4N3O/c1-4-5-18-10-9(8(2)3)11(20-7-19-10)21-6-13(16,17)12(14)15/h7-8,12H,4-6H2,1-3H3,(H,18,19,20) |
| InChIKey | KRJUAOFSJBOUAJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|