About 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol
1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol (PubChem CID 80843196) has the molecular formula C9H14ClN5O
and a molecular weight of 243.70 g/mol. Its IUPAC name is 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol |
| PubChem CID | 80843196 |
| Molecular Formula | C9H14ClN5O |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol |
| SMILES | Nc1nc(Cl)nc(NCC2(O)CCCC2)n1 |
| InChI | InChI=1S/C9H14ClN5O/c10-6-13-7(11)15-8(14-6)12-5-9(16)3-1-2-4-9/h16H,1-5H2,(H3,11,12,13,14,15) |
| InChIKey | AJANCHYVLXFJJM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol?
The IUPAC name of 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol (CID 80843196) is 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol is Nc1nc(Cl)nc(NCC2(O)CCCC2)n1.
What is the InChIKey of 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol?
The InChIKey is AJANCHYVLXFJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN5O/c10-6-13-7(11)15-8(14-6)12-5-9(16)3-1-2-4-9/h16H,1-5H2,(H3,11,12,13,14,15).
What are the key properties of 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol?
1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol has a molecular weight of 243.70 g/mol, XLogP of 0.82, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 80843196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).