C10H5Cl3N6S — CID 80843556
5-chloro-4-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pyrimidine-2,4-diamine (PubChem CID 80843556) has the molecular formula C10H5Cl3N6S and a molecular weight of 347.62 g/mol. Its IUPAC name is 5-chloro-4-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80843556 |
| Molecular Formula | C10H5Cl3N6S |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 5-chloro-4-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cl)c(Nc2c(Cl)cc(Cl)c3c2N=S=N3)n1 |
| InChI | InChI=1S/C10H5Cl3N6S/c11-3-1-4(12)7-8(19-20-18-7)6(3)16-9-5(13)2-15-10(14)17-9/h1-2H,(H3,14,15,16,17) |
| InChIKey | DVMRUXXJUSRZNZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |