C11H17F3N4O — CID 80845406
5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 80845406) has the molecular formula C11H17F3N4O and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80845406 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | CC(C)c1c(N)ncnc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N4O/c1-7(2)8-9(15)17-6-18-10(8)16-3-4-19-5-11(12,13)14/h6-7H,3-5H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | CUAXMDSUWFHYDW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|