C11H18F3N5O — CID 80845777
6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4,6-triamine (PubChem CID 80845777) has the molecular formula C11H18F3N5O and a molecular weight of 293.29 g/mol. Its IUPAC name is 6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80845777 |
| Molecular Formula | C11H18F3N5O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 6-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4,6-triamine |
| SMILES | CCCNc1cc(NCCOCC(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C11H18F3N5O/c1-2-3-16-8-6-9(19-10(15)18-8)17-4-5-20-7-11(12,13)14/h6H,2-5,7H2,1H3,(H4,15,16,17,18,19) |
| InChIKey | LUEMEPLHPJYJEJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|